About 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol
8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 63769276) has the molecular formula C15H30N2O
and a molecular weight of 254.42 g/mol. Its IUPAC name is 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 63769276 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CNC(CCN1C2CCC1CC(O)C2)C(C)(C)C |
| InChI | InChI=1S/C15H30N2O/c1-15(2,3)14(16-4)7-8-17-11-5-6-12(17)10-13(18)9-11/h11-14,16,18H,5-10H2,1-4H3 |
| InChIKey | DMCVSZYXNGRWFZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol (CID 63769276) is 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol is CNC(CCN1C2CCC1CC(O)C2)C(C)(C)C.
What is the InChIKey of 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol?
The InChIKey is DMCVSZYXNGRWFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O/c1-15(2,3)14(16-4)7-8-17-11-5-6-12(17)10-13(18)9-11/h11-14,16,18H,5-10H2,1-4H3.
What are the key properties of 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol?
8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol has a molecular weight of 254.42 g/mol, XLogP of 2.00, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4,4-dimethyl-3-(methylamino)pentyl]-8-azabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 63769276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).