About 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile
2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile (PubChem CID 63769357) has the molecular formula C16H17N3O2
and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile |
| PubChem CID | 63769357 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile |
| SMILES | Cc1cc(=O)n(CCOc2ccc(CC#N)cc2)c(C)n1 |
| InChI | InChI=1S/C16H17N3O2/c1-12-11-16(20)19(13(2)18-12)9-10-21-15-5-3-14(4-6-15)7-8-17/h3-6,11H,7,9-10H2,1-2H3 |
| InChIKey | YSPOKZZSCPIBKS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile?
The IUPAC name of 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile (CID 63769357) is 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile.
What is the SMILES notation for 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile?
The canonical SMILES for 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile is Cc1cc(=O)n(CCOc2ccc(CC#N)cc2)c(C)n1.
What is the InChIKey of 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile?
The InChIKey is YSPOKZZSCPIBKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2/c1-12-11-16(20)19(13(2)18-12)9-10-21-15-5-3-14(4-6-15)7-8-17/h3-6,11H,7,9-10H2,1-2H3.
What are the key properties of 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile?
2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile has a molecular weight of 283.33 g/mol, XLogP of 2.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(2,4-dimethyl-6-oxopyrimidin-1-yl)ethoxy]phenyl]acetonitrile is sourced from PubChem (CID 63769357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).