About 3-(3,3-diethoxypropyl)pyrimidin-4-one
3-(3,3-diethoxypropyl)pyrimidin-4-one (PubChem CID 63769542) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-(3,3-diethoxypropyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(3,3-diethoxypropyl)pyrimidin-4-one |
| PubChem CID | 63769542 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 3-(3,3-diethoxypropyl)pyrimidin-4-one |
| SMILES | CCOC(CCn1cnccc1=O)OCC |
| InChI | InChI=1S/C11H18N2O3/c1-3-15-11(16-4-2)6-8-13-9-12-7-5-10(13)14/h5,7,9,11H,3-4,6,8H2,1-2H3 |
| InChIKey | TXWAQVDCXHJINU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-diethoxypropyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-diethoxypropyl)pyrimidin-4-one?
The IUPAC name of 3-(3,3-diethoxypropyl)pyrimidin-4-one (CID 63769542) is 3-(3,3-diethoxypropyl)pyrimidin-4-one.
What is the SMILES notation for 3-(3,3-diethoxypropyl)pyrimidin-4-one?
The canonical SMILES for 3-(3,3-diethoxypropyl)pyrimidin-4-one is CCOC(CCn1cnccc1=O)OCC.
What is the InChIKey of 3-(3,3-diethoxypropyl)pyrimidin-4-one?
The InChIKey is TXWAQVDCXHJINU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-3-15-11(16-4-2)6-8-13-9-12-7-5-10(13)14/h5,7,9,11H,3-4,6,8H2,1-2H3.
What are the key properties of 3-(3,3-diethoxypropyl)pyrimidin-4-one?
3-(3,3-diethoxypropyl)pyrimidin-4-one has a molecular weight of 226.28 g/mol, XLogP of 1.03, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-diethoxypropyl)pyrimidin-4-one is sourced from PubChem (CID 63769542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).