C9H8ClN3OS — CID 63769732
3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]pyrimidin-4-one (PubChem CID 63769732) has the molecular formula C9H8ClN3OS and a molecular weight of 241.70 g/mol. Its IUPAC name is 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]pyrimidin-4-one.
| Compound Name | 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 63769732 |
| Molecular Formula | C9H8ClN3OS |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]pyrimidin-4-one |
| SMILES | O=c1ccncn1Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C9H8ClN3OS/c10-3-7-5-15-8(12-7)4-13-6-11-2-1-9(13)14/h1-2,5-6H,3-4H2 |
| InChIKey | FVVKRRDEQSDNJC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|