About 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one
3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one (PubChem CID 63769735) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one |
| PubChem CID | 63769735 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(CCCO)c(C)n1 |
| InChI | InChI=1S/C9H14N2O2/c1-7-6-9(13)11(4-3-5-12)8(2)10-7/h6,12H,3-5H2,1-2H3 |
| InChIKey | MDSUBNFTNQIRMI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one?
The IUPAC name of 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one (CID 63769735) is 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one.
What is the SMILES notation for 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one?
The canonical SMILES for 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one is Cc1cc(=O)n(CCCO)c(C)n1.
What is the InChIKey of 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one?
The InChIKey is MDSUBNFTNQIRMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-7-6-9(13)11(4-3-5-12)8(2)10-7/h6,12H,3-5H2,1-2H3.
What are the key properties of 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one?
3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one has a molecular weight of 182.22 g/mol, XLogP of 0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxypropyl)-2,6-dimethylpyrimidin-4-one is sourced from PubChem (CID 63769735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).