3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid

C9H12N2O3 — CID 63770048

IUPAC3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid
SMILESCc1cc(=O)n(CCC(=O)O)c(C)n1
InChIInChI=1S/C9H12N2O3/c1-6-5-8(12)11(7(2)10-6)4-3-9(13)14/h5H,3-4H2,1-2H3,(H,13,14)
InChIKeyCNGRCMVZCUEWEY-UHFFFAOYSA-N
MW196.21 g/mol
LogP0.33
Rot. Bonds3

About 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid

3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid (PubChem CID 63770048) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid.

Molecular Properties

Compound Name3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid
PubChem CID63770048
Molecular FormulaC9H12N2O3
Molecular Weight196.21 g/mol
Exact Mass196.08
IUPAC Name3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid
SMILESCc1cc(=O)n(CCC(=O)O)c(C)n1
InChIInChI=1S/C9H12N2O3/c1-6-5-8(12)11(7(2)10-6)4-3-9(13)14/h5H,3-4H2,1-2H3,(H,13,14)
InChIKeyCNGRCMVZCUEWEY-UHFFFAOYSA-N
XLogP0.33
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.21
LogP ≤ 50.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid?
The IUPAC name of 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid (CID 63770048) is 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid.
What is the SMILES notation for 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid?
The canonical SMILES for 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid is Cc1cc(=O)n(CCC(=O)O)c(C)n1.
What is the InChIKey of 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid?
The InChIKey is CNGRCMVZCUEWEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-6-5-8(12)11(7(2)10-6)4-3-9(13)14/h5H,3-4H2,1-2H3,(H,13,14).
What are the key properties of 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid?
3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid has a molecular weight of 196.21 g/mol, XLogP of 0.33, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanoic acid is sourced from PubChem (CID 63770048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).