About [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid
[2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid (PubChem CID 63770082) has the molecular formula C13H15BN2O3
and a molecular weight of 258.09 g/mol. Its IUPAC name is [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid.
Molecular Properties
| Compound Name | [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid |
| PubChem CID | 63770082 |
| Molecular Formula | C13H15BN2O3 |
| Molecular Weight | 258.09 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid |
| SMILES | Cc1cc(=O)n(Cc2ccccc2B(O)O)c(C)n1 |
| InChI | InChI=1S/C13H15BN2O3/c1-9-7-13(17)16(10(2)15-9)8-11-5-3-4-6-12(11)14(18)19/h3-7,18-19H,8H2,1-2H3 |
| InChIKey | OFZGFTFJKCEELR-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.09 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid?
The IUPAC name of [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid (CID 63770082) is [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid.
What is the SMILES notation for [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid?
The canonical SMILES for [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid is Cc1cc(=O)n(Cc2ccccc2B(O)O)c(C)n1.
What is the InChIKey of [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid?
The InChIKey is OFZGFTFJKCEELR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BN2O3/c1-9-7-13(17)16(10(2)15-9)8-11-5-3-4-6-12(11)14(18)19/h3-7,18-19H,8H2,1-2H3.
What are the key properties of [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid?
[2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid has a molecular weight of 258.09 g/mol, XLogP of -0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]phenyl]boronic acid is sourced from PubChem (CID 63770082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).