About 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide
3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide (PubChem CID 63770272) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide.
Molecular Properties
| Compound Name | 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide |
| PubChem CID | 63770272 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide |
| SMILES | Cc1cc(=O)n(CCC(N)=O)c(C)n1 |
| InChI | InChI=1S/C9H13N3O2/c1-6-5-9(14)12(7(2)11-6)4-3-8(10)13/h5H,3-4H2,1-2H3,(H2,10,13) |
| InChIKey | GKMAJPWSNDERMI-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide?
The IUPAC name of 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide (CID 63770272) is 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide.
What is the SMILES notation for 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide?
The canonical SMILES for 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide is Cc1cc(=O)n(CCC(N)=O)c(C)n1.
What is the InChIKey of 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide?
The InChIKey is GKMAJPWSNDERMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-6-5-9(14)12(7(2)11-6)4-3-8(10)13/h5H,3-4H2,1-2H3,(H2,10,13).
What are the key properties of 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide?
3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide has a molecular weight of 195.22 g/mol, XLogP of -0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)propanamide is sourced from PubChem (CID 63770272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).