C18H21NO — CID 63771297
N-methyl-4-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)aniline (PubChem CID 63771297) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is N-methyl-4-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)aniline.
| Compound Name | N-methyl-4-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)aniline |
|---|---|
| PubChem CID | 63771297 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-methyl-4-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)aniline |
| SMILES | CNc1ccc(OCC2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H21NO/c1-19-16-9-11-17(12-10-16)20-13-15-7-4-6-14-5-2-3-8-18(14)15/h2-3,5,8-12,15,19H,4,6-7,13H2,1H3 |
| InChIKey | KPPSFYMVSVCHRA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|