C22H21FN2O5S2 — CID 6377208
N-[2-[(5E)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 6377208) has the molecular formula C22H21FN2O5S2 and a molecular weight of 476.55 g/mol. Its IUPAC name is N-[2-[(5E)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-[2-[(5E)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 6377208 |
| Molecular Formula | C22H21FN2O5S2 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | N-[2-[(5E)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)NCCN2C(=O)S/C(=C/c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H21FN2O5S2/c1-15-2-8-18(9-3-15)32(29,30)13-10-20(26)24-11-12-25-21(27)19(31-22(25)28)14-16-4-6-17(23)7-5-16/h2-9,14H,10-13H2,1H3,(H,24,26)/b19-14+ |
| InChIKey | RSZRVDTUKFTTCM-XMHGGMMESA-N |
| XLogP | 3.15 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|