C15H19FN2O2 — CID 63772330
1-cyclopropyl-2-(diethoxymethyl)-6-fluorobenzimidazole (PubChem CID 63772330) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is 1-cyclopropyl-2-(diethoxymethyl)-6-fluorobenzimidazole.
| Compound Name | 1-cyclopropyl-2-(diethoxymethyl)-6-fluorobenzimidazole |
|---|---|
| PubChem CID | 63772330 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1-cyclopropyl-2-(diethoxymethyl)-6-fluorobenzimidazole |
| SMILES | CCOC(OCC)c1nc2ccc(F)cc2n1C1CC1 |
| InChI | InChI=1S/C15H19FN2O2/c1-3-19-15(20-4-2)14-17-12-8-5-10(16)9-13(12)18(14)11-6-7-11/h5,8-9,11,15H,3-4,6-7H2,1-2H3 |
| InChIKey | NZADPCPGVQLXTK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|