About 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine
6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 63772338) has the molecular formula C11H14BrN3O2
and a molecular weight of 300.16 g/mol. Its IUPAC name is 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 63772338 |
| Molecular Formula | C11H14BrN3O2 |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | CCOC(OCC)c1nc2ncc(Br)cc2[nH]1 |
| InChI | InChI=1S/C11H14BrN3O2/c1-3-16-11(17-4-2)10-14-8-5-7(12)6-13-9(8)15-10/h5-6,11H,3-4H2,1-2H3,(H,13,14,15) |
| InChIKey | JFAQXNSLLVPOMU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine (CID 63772338) is 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine is CCOC(OCC)c1nc2ncc(Br)cc2[nH]1.
What is the InChIKey of 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine?
The InChIKey is JFAQXNSLLVPOMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrN3O2/c1-3-16-11(17-4-2)10-14-8-5-7(12)6-13-9(8)15-10/h5-6,11H,3-4H2,1-2H3,(H,13,14,15).
What are the key properties of 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine?
6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine has a molecular weight of 300.16 g/mol, XLogP of 2.79, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(diethoxymethyl)-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 63772338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).