C16H24N2 — CID 63772764
1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-1,4-diazepane (PubChem CID 63772764) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-1,4-diazepane.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 63772764 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-1,4-diazepane |
| SMILES | c1ccc2c(c1)CCCC2CN1CCCNCC1 |
| InChI | InChI=1S/C16H24N2/c1-2-8-16-14(5-1)6-3-7-15(16)13-18-11-4-9-17-10-12-18/h1-2,5,8,15,17H,3-4,6-7,9-13H2 |
| InChIKey | YAZIOLTZBXCYEE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |