About (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine
(1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine (PubChem CID 63773451) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine.
Molecular Properties
| Compound Name | (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine |
| PubChem CID | 63773451 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine |
| SMILES | Cn1ncc2cc(CN)cnc21 |
| InChI | InChI=1S/C8H10N4/c1-12-8-7(5-11-12)2-6(3-9)4-10-8/h2,4-5H,3,9H2,1H3 |
| InChIKey | DMNAUFDGIJTOTG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine?
The IUPAC name of (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine (CID 63773451) is (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine.
What is the SMILES notation for (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine?
The canonical SMILES for (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine is Cn1ncc2cc(CN)cnc21.
What is the InChIKey of (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine?
The InChIKey is DMNAUFDGIJTOTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-12-8-7(5-11-12)2-6(3-9)4-10-8/h2,4-5H,3,9H2,1H3.
What are the key properties of (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine?
(1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine has a molecular weight of 162.20 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrazolo[5,4-b]pyridin-5-yl)methanamine is sourced from PubChem (CID 63773451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).