C13H12ClFOS — CID 63773688
1-(3-chloro-4-fluorophenyl)-3-thiophen-2-ylpropan-1-ol (PubChem CID 63773688) has the molecular formula C13H12ClFOS and a molecular weight of 270.76 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-thiophen-2-ylpropan-1-ol.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 63773688 |
| Molecular Formula | C13H12ClFOS |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-thiophen-2-ylpropan-1-ol |
| SMILES | OC(CCc1cccs1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H12ClFOS/c14-11-8-9(3-5-12(11)15)13(16)6-4-10-2-1-7-17-10/h1-3,5,7-8,13,16H,4,6H2 |
| InChIKey | ITWRWKYFXJIFIK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |