C13H15FO — CID 637738
(1S,2S,4R)-2-(4-fluorophenyl)bicyclo[2.2.1]heptan-2-ol (PubChem CID 637738) has the molecular formula C13H15FO and a molecular weight of 206.26 g/mol. Its IUPAC name is (1S,2S,4R)-2-(4-fluorophenyl)bicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,2S,4R)-2-(4-fluorophenyl)bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 637738 |
| Molecular Formula | C13H15FO |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (1S,2S,4R)-2-(4-fluorophenyl)bicyclo[2.2.1]heptan-2-ol |
| SMILES | O[C@@]1(c2ccc(F)cc2)C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C13H15FO/c14-12-5-3-10(4-6-12)13(15)8-9-1-2-11(13)7-9/h3-6,9,11,15H,1-2,7-8H2/t9-,11+,13-/m1/s1 |
| InChIKey | FOVSWUKJXLUKBY-SUZMYJTESA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |