C14H17NS — CID 63774162
3,5-dimethyl-N-(2-thiophen-2-ylethyl)aniline (PubChem CID 63774162) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is 3,5-dimethyl-N-(2-thiophen-2-ylethyl)aniline.
| Compound Name | 3,5-dimethyl-N-(2-thiophen-2-ylethyl)aniline |
|---|---|
| PubChem CID | 63774162 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 3,5-dimethyl-N-(2-thiophen-2-ylethyl)aniline |
| SMILES | Cc1cc(C)cc(NCCc2cccs2)c1 |
| InChI | InChI=1S/C14H17NS/c1-11-8-12(2)10-13(9-11)15-6-5-14-4-3-7-16-14/h3-4,7-10,15H,5-6H2,1-2H3 |
| InChIKey | KSJVFDZAZSQRSY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |