C15H25NOS — CID 63774465
N-[[3-(2-thiophen-2-ylethyl)oxan-3-yl]methyl]propan-1-amine (PubChem CID 63774465) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is N-[[3-(2-thiophen-2-ylethyl)oxan-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-(2-thiophen-2-ylethyl)oxan-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63774465 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N-[[3-(2-thiophen-2-ylethyl)oxan-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1(CCc2cccs2)CCCOC1 |
| InChI | InChI=1S/C15H25NOS/c1-2-9-16-12-15(7-4-10-17-13-15)8-6-14-5-3-11-18-14/h3,5,11,16H,2,4,6-10,12-13H2,1H3 |
| InChIKey | GXKGDTYFBLVALF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|