About 2-(4-hydroxyphenyl)ethyl acetate
2-(4-hydroxyphenyl)ethyl acetate (PubChem CID 637753) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)ethyl acetate |
| PubChem CID | 637753 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-(4-hydroxyphenyl)ethyl acetate |
| SMILES | CC(=O)OCCc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12O3/c1-8(11)13-7-6-9-2-4-10(12)5-3-9/h2-5,12H,6-7H2,1H3 |
| InChIKey | LDLOCPJLLDCCGO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-hydroxyphenyl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)ethyl acetate?
The IUPAC name of 2-(4-hydroxyphenyl)ethyl acetate (CID 637753) is 2-(4-hydroxyphenyl)ethyl acetate.
What is the SMILES notation for 2-(4-hydroxyphenyl)ethyl acetate?
The canonical SMILES for 2-(4-hydroxyphenyl)ethyl acetate is CC(=O)OCCc1ccc(O)cc1.
What is the InChIKey of 2-(4-hydroxyphenyl)ethyl acetate?
The InChIKey is LDLOCPJLLDCCGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-8(11)13-7-6-9-2-4-10(12)5-3-9/h2-5,12H,6-7H2,1H3.
What are the key properties of 2-(4-hydroxyphenyl)ethyl acetate?
2-(4-hydroxyphenyl)ethyl acetate has a molecular weight of 180.20 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)ethyl acetate is sourced from PubChem (CID 637753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).