About [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol
[4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol (PubChem CID 63776596) has the molecular formula C15H17N3O
and a molecular weight of 255.32 g/mol. Its IUPAC name is [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol.
Molecular Properties
| Compound Name | [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol |
| PubChem CID | 63776596 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol |
| SMILES | CN1CCN(c2ccnc(CO)c2)c2ccccc21 |
| InChI | InChI=1S/C15H17N3O/c1-17-8-9-18(15-5-3-2-4-14(15)17)13-6-7-16-12(10-13)11-19/h2-7,10,19H,8-9,11H2,1H3 |
| InChIKey | OAFAYDSRXSPFEF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol?
The IUPAC name of [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol (CID 63776596) is [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol.
What is the SMILES notation for [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol?
The canonical SMILES for [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol is CN1CCN(c2ccnc(CO)c2)c2ccccc21.
What is the InChIKey of [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol?
The InChIKey is OAFAYDSRXSPFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O/c1-17-8-9-18(15-5-3-2-4-14(15)17)13-6-7-16-12(10-13)11-19/h2-7,10,19H,8-9,11H2,1H3.
What are the key properties of [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol?
[4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol has a molecular weight of 255.32 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methyl-2,3-dihydroquinoxalin-1-yl)-2-pyridinyl]methanol is sourced from PubChem (CID 63776596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).