About [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol
[1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol (PubChem CID 63776974) has the molecular formula C17H26N2O
and a molecular weight of 274.41 g/mol. Its IUPAC name is [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol |
| PubChem CID | 63776974 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol |
| SMILES | CN1CCN(CC2(CO)CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C17H26N2O/c1-18-11-12-19(16-8-4-3-7-15(16)18)13-17(14-20)9-5-2-6-10-17/h3-4,7-8,20H,2,5-6,9-14H2,1H3 |
| InChIKey | OJXJMEZPPCNILG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol?
The IUPAC name of [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol (CID 63776974) is [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol.
What is the SMILES notation for [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol?
The canonical SMILES for [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol is CN1CCN(CC2(CO)CCCCC2)c2ccccc21.
What is the InChIKey of [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol?
The InChIKey is OJXJMEZPPCNILG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O/c1-18-11-12-19(16-8-4-3-7-15(16)18)13-17(14-20)9-5-2-6-10-17/h3-4,7-8,20H,2,5-6,9-14H2,1H3.
What are the key properties of [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol?
[1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol has a molecular weight of 274.41 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]cyclohexyl]methanol is sourced from PubChem (CID 63776974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).