About 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline
1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline (PubChem CID 63777504) has the molecular formula C12H17BrN2
and a molecular weight of 269.19 g/mol. Its IUPAC name is 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline.
Molecular Properties
| Compound Name | 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline |
| PubChem CID | 63777504 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline |
| SMILES | CN1CCN(CCCBr)c2ccccc21 |
| InChI | InChI=1S/C12H17BrN2/c1-14-9-10-15(8-4-7-13)12-6-3-2-5-11(12)14/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | OMVTVWFKCYFVDP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline?
The IUPAC name of 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline (CID 63777504) is 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline.
What is the SMILES notation for 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline?
The canonical SMILES for 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline is CN1CCN(CCCBr)c2ccccc21.
What is the InChIKey of 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline?
The InChIKey is OMVTVWFKCYFVDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2/c1-14-9-10-15(8-4-7-13)12-6-3-2-5-11(12)14/h2-3,5-6H,4,7-10H2,1H3.
What are the key properties of 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline?
1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline has a molecular weight of 269.19 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromopropyl)-4-methyl-2,3-dihydroquinoxaline is sourced from PubChem (CID 63777504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).