About 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol
1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol (PubChem CID 63777540) has the molecular formula C14H17N3OS
and a molecular weight of 275.38 g/mol. Its IUPAC name is 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol.
Molecular Properties
| Compound Name | 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol |
| PubChem CID | 63777540 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol |
| SMILES | CC(O)c1cnc(N2CCN(C)c3ccccc32)s1 |
| InChI | InChI=1S/C14H17N3OS/c1-10(18)13-9-15-14(19-13)17-8-7-16(2)11-5-3-4-6-12(11)17/h3-6,9-10,18H,7-8H2,1-2H3 |
| InChIKey | WJMLRBUTYVPAMG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol?
The IUPAC name of 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol (CID 63777540) is 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol.
What is the SMILES notation for 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol?
The canonical SMILES for 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol is CC(O)c1cnc(N2CCN(C)c3ccccc32)s1.
What is the InChIKey of 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol?
The InChIKey is WJMLRBUTYVPAMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3OS/c1-10(18)13-9-15-14(19-13)17-8-7-16(2)11-5-3-4-6-12(11)17/h3-6,9-10,18H,7-8H2,1-2H3.
What are the key properties of 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol?
1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol has a molecular weight of 275.38 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-methyl-2,3-dihydroquinoxalin-1-yl)-1,3-thiazol-5-yl]ethanol is sourced from PubChem (CID 63777540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).