About Molybdenum, pentacarbonyl(triphenylarsine)-
Molybdenum, pentacarbonyl(triphenylarsine)- (PubChem CID 6377774) has the molecular formula C23H16AsMoO5
and a molecular weight of 543.24 g/mol.
Molecular Properties
| Compound Name | Molybdenum, pentacarbonyl(triphenylarsine)- |
| PubChem CID | 6377774 |
| Molecular Formula | C23H16AsMoO5 |
| Molecular Weight | 543.24 g/mol |
| Exact Mass | 544.93 |
| IUPAC Name | — |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mo].c1ccc([AsH](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16As.5CO.Mo/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;5*1-2;/h1-15,19H;;;;;; |
| InChIKey | GOZRWSUDFDRWSW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 99.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 543.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Molybdenum, pentacarbonyl(triphenylarsine)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Molybdenum, pentacarbonyl(triphenylarsine)-?
The IUPAC name of Molybdenum, pentacarbonyl(triphenylarsine)- (CID 6377774) is not available.
What is the SMILES notation for Molybdenum, pentacarbonyl(triphenylarsine)-?
The canonical SMILES for Molybdenum, pentacarbonyl(triphenylarsine)- is [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mo].c1ccc([AsH](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of Molybdenum, pentacarbonyl(triphenylarsine)-?
The InChIKey is GOZRWSUDFDRWSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16As.5CO.Mo/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;5*1-2;/h1-15,19H;;;;;;.
What are the key properties of Molybdenum, pentacarbonyl(triphenylarsine)-?
Molybdenum, pentacarbonyl(triphenylarsine)- has a molecular weight of 543.24 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Molybdenum, pentacarbonyl(triphenylarsine)- is sourced from PubChem (CID 6377774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).