About (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide
(4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide (PubChem CID 63777859) has the molecular formula C14H17IN4O
and a molecular weight of 384.22 g/mol. Its IUPAC name is (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide.
Molecular Properties
| Compound Name | (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide |
| PubChem CID | 63777859 |
| Molecular Formula | C14H17IN4O |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide |
| SMILES | CN1CCN(C(=O)n2cc[n+](C)c2)c2ccccc21.[I-] |
| InChI | InChI=1S/C14H17N4O.HI/c1-15-7-9-17(11-15)14(19)18-10-8-16(2)12-5-3-4-6-13(12)18;/h3-7,9,11H,8,10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | FEBCTSPZFDNLIT-UHFFFAOYSA-M |
| XLogP | -1.76 |
| TPSA | 32.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide?
The IUPAC name of (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide (CID 63777859) is (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide.
What is the SMILES notation for (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide?
The canonical SMILES for (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide is CN1CCN(C(=O)n2cc[n+](C)c2)c2ccccc21.[I-].
What is the InChIKey of (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide?
The InChIKey is FEBCTSPZFDNLIT-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H17N4O.HI/c1-15-7-9-17(11-15)14(19)18-10-8-16(2)12-5-3-4-6-13(12)18;/h3-7,9,11H,8,10H2,1-2H3;1H/q+1;/p-1.
What are the key properties of (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide?
(4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide has a molecular weight of 384.22 g/mol, XLogP of -1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2,3-dihydroquinoxalin-1-yl)-(3-methylimidazol-3-ium-1-yl)methanone iodide is sourced from PubChem (CID 63777859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).