C15H28N2O — CID 6377814
(2E,5E)-2,6-bis(butylamino)hepta-2,5-dien-4-one (PubChem CID 6377814) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is (2E,5E)-2,6-bis(butylamino)hepta-2,5-dien-4-one.
| Compound Name | (2E,5E)-2,6-bis(butylamino)hepta-2,5-dien-4-one |
|---|---|
| PubChem CID | 6377814 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | (2E,5E)-2,6-bis(butylamino)hepta-2,5-dien-4-one |
| SMILES | CCCCN/C(C)=C/C(=O)/C=C(\C)NCCCC |
| InChI | InChI=1S/C15H28N2O/c1-5-7-9-16-13(3)11-15(18)12-14(4)17-10-8-6-2/h11-12,16-17H,5-10H2,1-4H3/b13-11+,14-12+ |
| InChIKey | ZQYCPLZINMEUGK-PHEQNACWSA-N |
| XLogP | 3.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|