About 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide
1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide (PubChem CID 63778164) has the molecular formula C9H10BrN7O3
and a molecular weight of 344.13 g/mol. Its IUPAC name is 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide.
Molecular Properties
| Compound Name | 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide |
| PubChem CID | 63778164 |
| Molecular Formula | C9H10BrN7O3 |
| Molecular Weight | 344.13 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide |
| SMILES | NNC(=O)c1cn(CCn2cc(Br)c(=O)[nH]c2=O)nn1 |
| InChI | InChI=1S/C9H10BrN7O3/c10-5-3-16(9(20)12-7(5)18)1-2-17-4-6(14-15-17)8(19)13-11/h3-4H,1-2,11H2,(H,13,19)(H,12,18,20) |
| InChIKey | GQWWPSQCHBHZMP-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 140.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.13 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide?
The IUPAC name of 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide (CID 63778164) is 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide.
What is the SMILES notation for 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide?
The canonical SMILES for 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide is NNC(=O)c1cn(CCn2cc(Br)c(=O)[nH]c2=O)nn1.
What is the InChIKey of 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide?
The InChIKey is GQWWPSQCHBHZMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN7O3/c10-5-3-16(9(20)12-7(5)18)1-2-17-4-6(14-15-17)8(19)13-11/h3-4H,1-2,11H2,(H,13,19)(H,12,18,20).
What are the key properties of 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide?
1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide has a molecular weight of 344.13 g/mol, XLogP of -1.81, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(5-bromo-2,4-dioxopyrimidin-1-yl)ethyl]triazole-4-carbohydrazide is sourced from PubChem (CID 63778164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).