C14H21N3O — CID 63778262
2-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]morpholine (PubChem CID 63778262) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]morpholine.
| Compound Name | 2-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]morpholine |
|---|---|
| PubChem CID | 63778262 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]morpholine |
| SMILES | CN1CCN(CC2CNCCO2)c2ccccc21 |
| InChI | InChI=1S/C14H21N3O/c1-16-7-8-17(11-12-10-15-6-9-18-12)14-5-3-2-4-13(14)16/h2-5,12,15H,6-11H2,1H3 |
| InChIKey | FDZFGMRZNBRINI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |