About 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide
3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide (PubChem CID 63778341) has the molecular formula C10H9BrN4O3S
and a molecular weight of 345.18 g/mol. Its IUPAC name is 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide.
Molecular Properties
| Compound Name | 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide |
| PubChem CID | 63778341 |
| Molecular Formula | C10H9BrN4O3S |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1sccc1Cn1cc(Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H9BrN4O3S/c11-6-4-15(10(18)13-8(6)16)3-5-1-2-19-7(5)9(17)14-12/h1-2,4H,3,12H2,(H,14,17)(H,13,16,18) |
| InChIKey | ROFRWRQSNLOSKR-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide?
The IUPAC name of 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide (CID 63778341) is 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide.
What is the SMILES notation for 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide?
The canonical SMILES for 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide is NNC(=O)c1sccc1Cn1cc(Br)c(=O)[nH]c1=O.
What is the InChIKey of 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide?
The InChIKey is ROFRWRQSNLOSKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN4O3S/c11-6-4-15(10(18)13-8(6)16)3-5-1-2-19-7(5)9(17)14-12/h1-2,4H,3,12H2,(H,14,17)(H,13,16,18).
What are the key properties of 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide?
3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide has a molecular weight of 345.18 g/mol, XLogP of 0.01, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-bromo-2,4-dioxopyrimidin-1-yl)methyl]thiophene-2-carbohydrazide is sourced from PubChem (CID 63778341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).