About 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine
3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine (PubChem CID 63778737) has the molecular formula C16H27N3
and a molecular weight of 261.41 g/mol. Its IUPAC name is 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine.
Molecular Properties
| Compound Name | 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine |
| PubChem CID | 63778737 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine |
| SMILES | CCC(CC)C(CN)N1CCN(C)c2ccccc21 |
| InChI | InChI=1S/C16H27N3/c1-4-13(5-2)16(12-17)19-11-10-18(3)14-8-6-7-9-15(14)19/h6-9,13,16H,4-5,10-12,17H2,1-3H3 |
| InChIKey | RMJVCUFOVDDFNW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine?
The IUPAC name of 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine (CID 63778737) is 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine.
What is the SMILES notation for 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine?
The canonical SMILES for 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine is CCC(CC)C(CN)N1CCN(C)c2ccccc21.
What is the InChIKey of 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine?
The InChIKey is RMJVCUFOVDDFNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3/c1-4-13(5-2)16(12-17)19-11-10-18(3)14-8-6-7-9-15(14)19/h6-9,13,16H,4-5,10-12,17H2,1-3H3.
What are the key properties of 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine?
3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine has a molecular weight of 261.41 g/mol, XLogP of 2.71, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)pentan-1-amine is sourced from PubChem (CID 63778737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).