About N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine
N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine (PubChem CID 63778931) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine |
| PubChem CID | 63778931 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine |
| SMILES | CNCCCN1CCN(C)c2ccccc21 |
| InChI | InChI=1S/C13H21N3/c1-14-8-5-9-16-11-10-15(2)12-6-3-4-7-13(12)16/h3-4,6-7,14H,5,8-11H2,1-2H3 |
| InChIKey | RROBRTIBRALNFV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine?
The IUPAC name of N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine (CID 63778931) is N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine.
What is the SMILES notation for N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine?
The canonical SMILES for N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine is CNCCCN1CCN(C)c2ccccc21.
What is the InChIKey of N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine?
The InChIKey is RROBRTIBRALNFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3/c1-14-8-5-9-16-11-10-15(2)12-6-3-4-7-13(12)16/h3-4,6-7,14H,5,8-11H2,1-2H3.
What are the key properties of N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine?
N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine has a molecular weight of 219.33 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-(4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-amine is sourced from PubChem (CID 63778931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).