About 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide
4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide (PubChem CID 63779301) has the molecular formula C17H20N4
and a molecular weight of 280.38 g/mol. Its IUPAC name is 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide.
Molecular Properties
| Compound Name | 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide |
| PubChem CID | 63779301 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C)cc1N1CCN(C)c2ccccc21 |
| InChI | InChI=1S/C17H20N4/c1-12-7-8-13(17(18)19)16(11-12)21-10-9-20(2)14-5-3-4-6-15(14)21/h3-8,11H,9-10H2,1-2H3,(H3,18,19) |
| InChIKey | FFBFRLGWPIYSRC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide?
The IUPAC name of 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide (CID 63779301) is 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide.
What is the SMILES notation for 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide?
The canonical SMILES for 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide is [H]/N=C(\N)c1ccc(C)cc1N1CCN(C)c2ccccc21.
What is the InChIKey of 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide?
The InChIKey is FFBFRLGWPIYSRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4/c1-12-7-8-13(17(18)19)16(11-12)21-10-9-20(2)14-5-3-4-6-15(14)21/h3-8,11H,9-10H2,1-2H3,(H3,18,19).
What are the key properties of 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide?
4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide has a molecular weight of 280.38 g/mol, XLogP of 2.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(4-methyl-2,3-dihydroquinoxalin-1-yl)benzenecarboximidamide is sourced from PubChem (CID 63779301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).