C13H22N2O4S — CID 63780284
2-cyclopropyl-3-(4-methoxybutylcarbamoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 63780284) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-cyclopropyl-3-(4-methoxybutylcarbamoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-cyclopropyl-3-(4-methoxybutylcarbamoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 63780284 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-cyclopropyl-3-(4-methoxybutylcarbamoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | COCCCCNC(=O)N1C(C(=O)O)CSC1C1CC1 |
| InChI | InChI=1S/C13H22N2O4S/c1-19-7-3-2-6-14-13(18)15-10(12(16)17)8-20-11(15)9-4-5-9/h9-11H,2-8H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | BSUCWWCTFAIOCL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|