About dimethyl penta-2,3-dienedioate
dimethyl penta-2,3-dienedioate (PubChem CID 637810) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is dimethyl penta-2,3-dienedioate.
Molecular Properties
| Compound Name | dimethyl penta-2,3-dienedioate |
| PubChem CID | 637810 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | dimethyl penta-2,3-dienedioate |
| SMILES | COC(=O)C=C=CC(=O)OC |
| InChI | InChI=1S/C7H8O4/c1-10-6(8)4-3-5-7(9)11-2/h4-5H,1-2H3 |
| InChIKey | FJLLBKDQCMPUSU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl penta-2,3-dienedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl penta-2,3-dienedioate?
The IUPAC name of dimethyl penta-2,3-dienedioate (CID 637810) is dimethyl penta-2,3-dienedioate.
What is the SMILES notation for dimethyl penta-2,3-dienedioate?
The canonical SMILES for dimethyl penta-2,3-dienedioate is COC(=O)C=C=CC(=O)OC.
What is the InChIKey of dimethyl penta-2,3-dienedioate?
The InChIKey is FJLLBKDQCMPUSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c1-10-6(8)4-3-5-7(9)11-2/h4-5H,1-2H3.
What are the key properties of dimethyl penta-2,3-dienedioate?
dimethyl penta-2,3-dienedioate has a molecular weight of 156.14 g/mol, XLogP of 0.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl penta-2,3-dienedioate is sourced from PubChem (CID 637810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).