About 1-diazopropylbenzene
1-diazopropylbenzene (PubChem CID 637813) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-diazopropylbenzene.
Molecular Properties
| Compound Name | 1-diazopropylbenzene |
| PubChem CID | 637813 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 1-diazopropylbenzene |
| SMILES | CCC(=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C9H10N2/c1-2-9(11-10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | LJTFEHMRMWNEIF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-diazopropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazopropylbenzene?
The IUPAC name of 1-diazopropylbenzene (CID 637813) is 1-diazopropylbenzene.
What is the SMILES notation for 1-diazopropylbenzene?
The canonical SMILES for 1-diazopropylbenzene is CCC(=[N+]=[N-])c1ccccc1.
What is the InChIKey of 1-diazopropylbenzene?
The InChIKey is LJTFEHMRMWNEIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-2-9(11-10)8-6-4-3-5-7-8/h3-7H,2H2,1H3.
What are the key properties of 1-diazopropylbenzene?
1-diazopropylbenzene has a molecular weight of 146.19 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazopropylbenzene is sourced from PubChem (CID 637813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).