4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid

C13H21NO4 — CID 63783007

IUPAC4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid
SMILESO=C(O)C1CCC(C(=O)N2CCCOCC2)CC1
InChIInChI=1S/C13H21NO4/c15-12(14-6-1-8-18-9-7-14)10-2-4-11(5-3-10)13(16)17/h10-11H,1-9H2,(H,16,17)
InChIKeyQYCPLHOEUMPJKH-UHFFFAOYSA-N
MW255.31 g/mol
LogP1.13
Rot. Bonds2

About 4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid

4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid (PubChem CID 63783007) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid
PubChem CID63783007
Molecular FormulaC13H21NO4
Molecular Weight255.31 g/mol
Exact Mass255.15
IUPAC Name4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid
SMILESO=C(O)C1CCC(C(=O)N2CCCOCC2)CC1
InChIInChI=1S/C13H21NO4/c15-12(14-6-1-8-18-9-7-14)10-2-4-11(5-3-10)13(16)17/h10-11H,1-9H2,(H,16,17)
InChIKeyQYCPLHOEUMPJKH-UHFFFAOYSA-N
XLogP1.13
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.31
LogP ≤ 51.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid?
The IUPAC name of 4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid (CID 63783007) is 4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid is O=C(O)C1CCC(C(=O)N2CCCOCC2)CC1.
What is the InChIKey of 4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid?
The InChIKey is QYCPLHOEUMPJKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO4/c15-12(14-6-1-8-18-9-7-14)10-2-4-11(5-3-10)13(16)17/h10-11H,1-9H2,(H,16,17).
What are the key properties of 4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid?
4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid has a molecular weight of 255.31 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-oxazepane-4-carbonyl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 63783007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).