About 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine
2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine (PubChem CID 63783199) has the molecular formula C14H20F2N2
and a molecular weight of 254.32 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine.
Molecular Properties
| Compound Name | 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine |
| PubChem CID | 63783199 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine |
| SMILES | CC1CCCN(c2c(F)cc(CCN)cc2F)C1 |
| InChI | InChI=1S/C14H20F2N2/c1-10-3-2-6-18(9-10)14-12(15)7-11(4-5-17)8-13(14)16/h7-8,10H,2-6,9,17H2,1H3 |
| InChIKey | HDLIEJAFMUAJDL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine?
The IUPAC name of 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine (CID 63783199) is 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine.
What is the SMILES notation for 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine?
The canonical SMILES for 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine is CC1CCCN(c2c(F)cc(CCN)cc2F)C1.
What is the InChIKey of 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine?
The InChIKey is HDLIEJAFMUAJDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N2/c1-10-3-2-6-18(9-10)14-12(15)7-11(4-5-17)8-13(14)16/h7-8,10H,2-6,9,17H2,1H3.
What are the key properties of 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine?
2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine has a molecular weight of 254.32 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-difluoro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine is sourced from PubChem (CID 63783199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).