C12H21NO5 — CID 63783484
3-[bis(2-hydroxyethyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 63783484) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-[bis(2-hydroxyethyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[bis(2-hydroxyethyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63783484 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-[bis(2-hydroxyethyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC(C(=O)N(CCO)CCO)C1 |
| InChI | InChI=1S/C12H21NO5/c14-6-4-13(5-7-15)11(16)9-2-1-3-10(8-9)12(17)18/h9-10,14-15H,1-8H2,(H,17,18) |
| InChIKey | AQVWYOQEYJFOIX-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |