C14H11F3N4 — CID 63783538
2,4,5-trifluoro-N-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]aniline (PubChem CID 63783538) has the molecular formula C14H11F3N4 and a molecular weight of 292.26 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]aniline.
| Compound Name | 2,4,5-trifluoro-N-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]aniline |
|---|---|
| PubChem CID | 63783538 |
| Molecular Formula | C14H11F3N4 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2,4,5-trifluoro-N-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]aniline |
| SMILES | Cc1cc2ncc(CNc3cc(F)c(F)cc3F)cn2n1 |
| InChI | InChI=1S/C14H11F3N4/c1-8-2-14-19-6-9(7-21(14)20-8)5-18-13-4-11(16)10(15)3-12(13)17/h2-4,6-7,18H,5H2,1H3 |
| InChIKey | CQSMJLGZIQOVNJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|