About 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine (PubChem CID 6378383) has the molecular formula C25H27NO
and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine.
Molecular Properties
| Compound Name | 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine |
| PubChem CID | 6378383 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCNC)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H27NO/c1-3-24(20-10-6-4-7-11-20)25(21-12-8-5-9-13-21)22-14-16-23(17-15-22)27-19-18-26-2/h4-17,26H,3,18-19H2,1-2H3/b25-24- |
| InChIKey | NYDCDZSEEAUOHN-IZHYLOQSSA-N |
| XLogP | 5.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine?
The IUPAC name of 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine (CID 6378383) is 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine.
What is the SMILES notation for 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine?
The canonical SMILES for 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine is CC/C(=C(\c1ccccc1)c1ccc(OCCNC)cc1)c1ccccc1.
What is the InChIKey of 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine?
The InChIKey is NYDCDZSEEAUOHN-IZHYLOQSSA-N. The full InChI is InChI=1S/C25H27NO/c1-3-24(20-10-6-4-7-11-20)25(21-12-8-5-9-13-21)22-14-16-23(17-15-22)27-19-18-26-2/h4-17,26H,3,18-19H2,1-2H3/b25-24-.
What are the key properties of 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine?
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine has a molecular weight of 357.50 g/mol, XLogP of 5.65, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine is sourced from PubChem (CID 6378383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).