C35H43N3O7 — CID 637849
(2R)-2-[[(2S)-2-[[(2R)-2-(hexanoylamino)-4-(4-hydroxyphenyl)butanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]amino]-3-phenylpropanoic acid (PubChem CID 637849) has the molecular formula C35H43N3O7 and a molecular weight of 617.74 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[[(2R)-2-(hexanoylamino)-4-(4-hydroxyphenyl)butanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-[[(2R)-2-(hexanoylamino)-4-(4-hydroxyphenyl)butanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 637849 |
| Molecular Formula | C35H43N3O7 |
| Molecular Weight | 617.74 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | (2R)-2-[[(2S)-2-[[(2R)-2-(hexanoylamino)-4-(4-hydroxyphenyl)butanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CCCCCC(=O)N[C@H](CCc1ccc(O)cc1)C(=O)N[C@@H](CCc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C35H43N3O7/c1-2-3-5-10-32(41)36-29(21-15-24-11-17-27(39)18-12-24)33(42)37-30(22-16-25-13-19-28(40)20-14-25)34(43)38-31(35(44)45)23-26-8-6-4-7-9-26/h4,6-9,11-14,17-20,29-31,39-40H,2-3,5,10,15-16,21-23H2,1H3,(H,36,41)(H,37,42)(H,38,43)(H,44,45)/t29-,30+,31-/m1/s1 |
| InChIKey | XFLVJFHNXBWJDL-MJSOWUPRSA-N |
| XLogP | 4.03 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.74 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|