About 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine
2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine (PubChem CID 63786834) has the molecular formula C16H19BrN2S
and a molecular weight of 351.31 g/mol. Its IUPAC name is 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine |
| PubChem CID | 63786834 |
| Molecular Formula | C16H19BrN2S |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine |
| SMILES | CC1c2ccsc2CCN1c1cc(Br)ccc1CCN |
| InChI | InChI=1S/C16H19BrN2S/c1-11-14-6-9-20-16(14)5-8-19(11)15-10-13(17)3-2-12(15)4-7-18/h2-3,6,9-11H,4-5,7-8,18H2,1H3 |
| InChIKey | UDJTZJZNDHNCCX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine?
The IUPAC name of 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine (CID 63786834) is 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine.
What is the SMILES notation for 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine?
The canonical SMILES for 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine is CC1c2ccsc2CCN1c1cc(Br)ccc1CCN.
What is the InChIKey of 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine?
The InChIKey is UDJTZJZNDHNCCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrN2S/c1-11-14-6-9-20-16(14)5-8-19(11)15-10-13(17)3-2-12(15)4-7-18/h2-3,6,9-11H,4-5,7-8,18H2,1H3.
What are the key properties of 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine?
2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine has a molecular weight of 351.31 g/mol, XLogP of 4.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-bromo-2-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]ethanamine is sourced from PubChem (CID 63786834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).