C17H22BrN3 — CID 63786995
2-(2-aminobutyl)-5-bromo-N-methyl-N-(pyridin-3-ylmethyl)aniline (PubChem CID 63786995) has the molecular formula C17H22BrN3 and a molecular weight of 348.29 g/mol. Its IUPAC name is 2-(2-aminobutyl)-5-bromo-N-methyl-N-(pyridin-3-ylmethyl)aniline.
| Compound Name | 2-(2-aminobutyl)-5-bromo-N-methyl-N-(pyridin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 63786995 |
| Molecular Formula | C17H22BrN3 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-(2-aminobutyl)-5-bromo-N-methyl-N-(pyridin-3-ylmethyl)aniline |
| SMILES | CCC(N)Cc1ccc(Br)cc1N(C)Cc1cccnc1 |
| InChI | InChI=1S/C17H22BrN3/c1-3-16(19)9-14-6-7-15(18)10-17(14)21(2)12-13-5-4-8-20-11-13/h4-8,10-11,16H,3,9,12,19H2,1-2H3 |
| InChIKey | KYSKKWSIFMFONS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |