About Tri(O-tolyl)silane
Tri(O-tolyl)silane (PubChem CID 6378790) has the molecular formula C21H21Si
and a molecular weight of 301.49 g/mol.
Molecular Properties
| Compound Name | Tri(O-tolyl)silane |
| PubChem CID | 6378790 |
| Molecular Formula | C21H21Si |
| Molecular Weight | 301.49 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1[Si](c1ccccc1C)c1ccccc1C |
| InChI | InChI=1S/C21H21Si/c1-16-10-4-7-13-19(16)22(20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3/h4-15H,1-3H3 |
| InChIKey | QVHFFTSYRWXNAI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze Tri(O-tolyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tri(O-tolyl)silane?
The IUPAC name of Tri(O-tolyl)silane (CID 6378790) is not available.
What is the SMILES notation for Tri(O-tolyl)silane?
The canonical SMILES for Tri(O-tolyl)silane is Cc1ccccc1[Si](c1ccccc1C)c1ccccc1C.
What is the InChIKey of Tri(O-tolyl)silane?
The InChIKey is QVHFFTSYRWXNAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21Si/c1-16-10-4-7-13-19(16)22(20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3/h4-15H,1-3H3.
What are the key properties of Tri(O-tolyl)silane?
Tri(O-tolyl)silane has a molecular weight of 301.49 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Tri(O-tolyl)silane is sourced from PubChem (CID 6378790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).