About methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate
methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 637881) has the molecular formula C7H7FN2O4
and a molecular weight of 202.14 g/mol. Its IUPAC name is methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate |
| PubChem CID | 637881 |
| Molecular Formula | C7H7FN2O4 |
| Molecular Weight | 202.14 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | COC(=O)Cn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H7FN2O4/c1-14-5(11)3-10-2-4(8)6(12)9-7(10)13/h2H,3H2,1H3,(H,9,12,13) |
| InChIKey | ATGWGHLJNFEABD-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.14 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate?
The IUPAC name of methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate (CID 637881) is methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate.
What is the SMILES notation for methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate?
The canonical SMILES for methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate is COC(=O)Cn1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate?
The InChIKey is ATGWGHLJNFEABD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN2O4/c1-14-5(11)3-10-2-4(8)6(12)9-7(10)13/h2H,3H2,1H3,(H,9,12,13).
What are the key properties of methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate?
methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate has a molecular weight of 202.14 g/mol, XLogP of -1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)acetate is sourced from PubChem (CID 637881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).