About tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate
tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate (PubChem CID 63788857) has the molecular formula C14H19F2NO2
and a molecular weight of 271.31 g/mol. Its IUPAC name is tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate.
Analyze tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate (CID 63788857) is tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate is CC(c1cc(F)ccc1F)N(C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate?
The InChIKey is AMVRRYLKPMGPNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2NO2/c1-9(11-8-10(15)6-7-12(11)16)17(5)13(18)19-14(2,3)4/h6-9H,1-5H3.
What are the key properties of tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate?
tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate has a molecular weight of 271.31 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(2,5-difluorophenyl)ethyl]-N-methylcarbamate is sourced from PubChem (CID 63788857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).