C22H24O7 — CID 637889
5-[(3S,3aR,6S,6aR)-3-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-4-methoxy-1,3-benzodioxole (PubChem CID 637889) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is 5-[(3S,3aR,6S,6aR)-3-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-4-methoxy-1,3-benzodioxole.
| Compound Name | 5-[(3S,3aR,6S,6aR)-3-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-4-methoxy-1,3-benzodioxole |
|---|---|
| PubChem CID | 637889 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 5-[(3S,3aR,6S,6aR)-3-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-4-methoxy-1,3-benzodioxole |
| SMILES | COc1ccc([C@H]2OC[C@H]3[C@@H]2CO[C@@H]3c2ccc3c(c2OC)OCO3)cc1OC |
| InChI | InChI=1S/C22H24O7/c1-23-16-6-4-12(8-18(16)24-2)19-14-9-27-20(15(14)10-26-19)13-5-7-17-22(21(13)25-3)29-11-28-17/h4-8,14-15,19-20H,9-11H2,1-3H3/t14-,15-,19+,20+/m0/s1 |
| InChIKey | VRYSIJRIXGPIBZ-IQGAEYHTSA-N |
| XLogP | 3.52 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |