About 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione
4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione (PubChem CID 63789057) has the molecular formula C9H13NO5
and a molecular weight of 215.20 g/mol. Its IUPAC name is 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione.
Molecular Properties
| Compound Name | 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione |
| PubChem CID | 63789057 |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione |
| SMILES | O=C1CN(CC2COCCO2)CC(=O)O1 |
| InChI | InChI=1S/C9H13NO5/c11-8-4-10(5-9(12)15-8)3-7-6-13-1-2-14-7/h7H,1-6H2 |
| InChIKey | ZJMOURZUWPFEKK-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione?
The IUPAC name of 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione (CID 63789057) is 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione.
What is the SMILES notation for 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione?
The canonical SMILES for 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione is O=C1CN(CC2COCCO2)CC(=O)O1.
What is the InChIKey of 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione?
The InChIKey is ZJMOURZUWPFEKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO5/c11-8-4-10(5-9(12)15-8)3-7-6-13-1-2-14-7/h7H,1-6H2.
What are the key properties of 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione?
4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione has a molecular weight of 215.20 g/mol, XLogP of -1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-dioxan-2-ylmethyl)morpholine-2,6-dione is sourced from PubChem (CID 63789057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).