About 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione
4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione (PubChem CID 63789062) has the molecular formula C8H8N2O3S
and a molecular weight of 212.23 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione.
Molecular Properties
| Compound Name | 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione |
| PubChem CID | 63789062 |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione |
| SMILES | O=C1CN(Cc2nccs2)CC(=O)O1 |
| InChI | InChI=1S/C8H8N2O3S/c11-7-4-10(5-8(12)13-7)3-6-9-1-2-14-6/h1-2H,3-5H2 |
| InChIKey | QYCAWBMEMWXNAT-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione?
The IUPAC name of 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione (CID 63789062) is 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione.
What is the SMILES notation for 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione?
The canonical SMILES for 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione is O=C1CN(Cc2nccs2)CC(=O)O1.
What is the InChIKey of 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione?
The InChIKey is QYCAWBMEMWXNAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3S/c11-7-4-10(5-8(12)13-7)3-6-9-1-2-14-6/h1-2H,3-5H2.
What are the key properties of 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione?
4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione has a molecular weight of 212.23 g/mol, XLogP of 0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-thiazol-2-ylmethyl)morpholine-2,6-dione is sourced from PubChem (CID 63789062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).