About tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate
tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate (PubChem CID 63790273) has the molecular formula C14H18FNO2S
and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate |
| PubChem CID | 63790273 |
| Molecular Formula | C14H18FNO2S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C14H18FNO2S/c1-14(2,3)18-13(17)16-11-6-7-19-12-5-4-9(15)8-10(11)12/h4-5,8,11H,6-7H2,1-3H3,(H,16,17) |
| InChIKey | GBEKKGACEKZOLQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate?
The IUPAC name of tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate (CID 63790273) is tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate.
What is the SMILES notation for tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate?
The canonical SMILES for tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate is CC(C)(C)OC(=O)NC1CCSc2ccc(F)cc21.
What is the InChIKey of tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate?
The InChIKey is GBEKKGACEKZOLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO2S/c1-14(2,3)18-13(17)16-11-6-7-19-12-5-4-9(15)8-10(11)12/h4-5,8,11H,6-7H2,1-3H3,(H,16,17).
What are the key properties of tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate?
tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate has a molecular weight of 283.37 g/mol, XLogP of 3.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)carbamate is sourced from PubChem (CID 63790273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).